A) 14.28g/cm3 B) 0.014g C) 14,000 g/cm3 D) 0.014 g/cm3
A) somewhat spread apart with little movement B) very far apart and feely moving C) somewhat spread apart with almost not movement D) very close together and freely moving
A) atom with different number of electrons B) atom with different number of energy levels C) atom with different number of neutrons D) atom with different number of protons
A) 4p B) 5s C) 3d D) 4d
A) S B) Na C) Si
A) nitrogen B) aluminum C) oxygen D) magnesium
A) 0.56x10-24atoms B) 18.3atoms C) 2.05x1024atoms D) 2.05atoms
A) 185.92mol B) 2.70mol C) 36.4x1023 mol D) 0.37mol
A) 24.67grams B) 117grams C) 222grams D) 0.041grams
A) AlCl2 B) Al2Cl3 C) AlCl3 D) Al2Cl
A) single-replacement B) composition C) decomposition D) combustion
A) combustion B) composition C) double-replacement D) single-replacement
A) balanced B) __,3,__,3 C) 3,__,__,3 D) __,3,3,__
A) coefficients B) reactants C) products D) subscripts
A) 39.6grams B) 138.7grams C) 52.0grams D) 65.6grams
A) Li=+2 O=-2 B) Li=+1 O=-1 C) Li=+2 O=-1 D) Li=+1 O=-2
A) 120 g/mol B) 76 g/mol C) 76 amu D) 120 amu
A) 2% B) 89% C) 11% D) 20%
A) 36 amu B) 36 g/mol C) 74 amu D) 74 g/mol
A) combustion B) double-displacement C) decomposition D) single-displacement E) synthesis
A) decompostion B) synthesis C) single-displacement D) combustion E) double-displacement
A) single-displacement B) combustion C) decompostion D) synthesis E) double-displacement
A) double-displacement B) combustion C) synthesis D) decomposition E) single-displacement
A) single-displacement B) combustion C) double-displacement D) decomposition E) synthesis
A) L B) K C) oC D) atm
A) L B) atm C) torr D) K
A) 0.001cm3 B) 395cm3 C) 13976cm3 D) 0.047cm3
A) 805mmHg B) 1071mmHg C) 1200mmHg D) 706mmHg
A) 303K B) 105.3K C) 581K D) 855K
A) 206K B) 352K C) 421K D) 500K
A) 49atm B) 18.9atm C) 32atm D) 15atm
A) Multiply by 273 B) Add 273 C) Divide by 273 D) Subtract 273
A) 1atm B) All of these C) 760 torr D) 101.325kPa
A) K B) Two of the above C) oC D) L
A) research B) experimentation C) organizing data D) communicating results
A) water B) sunlight C) music D) growth
A) growth B) music C) sunlight D) water
A) 8.6 B) 86000 C) 0.86 D) 860
A) heterogeneous mixture B) element C) homegeneous mixture D) compound
A) hydrogen B) air C) salt water D) two of these
A) combine to form new substances B) none of these C) maintain seperate identities D) are hard to pick out
A) physical property B) chemical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) halogens B) alkali metals C) transition metals D) noble gases
A) alphabetically B) by atomic mass C) by atomic number D) by date of discovery
A) Rutherford B) Thomson C) Millikan
A) Rutherford B) Thomson C) Millikan
A) 7 B) 8 C) 9 D) 6
A) it depends on the mass B) Not enough information C) 6.02x1023
A) 1s22s22p6 B) 1s22s22p5 C) 1s12s12p6 D) 1s12s22p5
A) [Kr]1s22s22p63s23p64s23d104p65s2 B) [Ar] 4s2 C) [Kr]5s2 D) [Ar]5s2
A) decreases B) increases
A) decreases B) increases
A) 6 B) 3 C) 12 D) 4
A) ionic B) metallic C) covalent D) special
A) covalent B) special C) metallic D) ionic
A) Mg2S B) MgS2 C) MgS4 D) MgS
A) CCl2 B) CCl4 C) CCl D) CCl3
A) iron (II) chloride B) iron (IV) chloride C) iron dichloride D) iron chloride
A) nitrogen chloride B) nitrogen (III)chloride C) trinitrogen hexachloride D) nitrogen hexachloride
A) donates/accepts electrons B) shares electrons
A) number of atoms B) how much it weighs C) charge D) nothing
A) transition metals B) 4A C) groups 1A,2A,3A and 4A D) two of these
A) __,3,__,3 B) __,3,3,__ C) 3,__,__,3 D) __,__,__,__
A) 2,__,2,__ B) __,__,__,__ C) __2,2,__ D) __,2,__,2
A) multipliers B) subscripts C) coefficients D) dividers
A) metalloids B) metals C) nonmetals
A) total protons B) total electrons C) total neutrons D) valence electrons
A) CrCl2 B) Cr2Cl C) CrCl D) Cr2Cl2
A) HF B) NaCl C) HCl D) NaOH
A) 12.5g B) 25 C) 50 D) 0g
A) neutral B) bases C) acids
A) ... B) ... C) Ms. Watson |