A) 14.28g/cm3 B) 0.014 g/cm3 C) 14,000 g/cm3 D) 0.014g
A) somewhat spread apart with almost not movement B) somewhat spread apart with little movement C) very far apart and feely moving D) very close together and freely moving
A) atom with different number of energy levels B) atom with different number of neutrons C) atom with different number of electrons D) atom with different number of protons
A) 4p B) 5s C) 4d D) 3d
A) S B) Si C) Na
A) magnesium B) nitrogen C) aluminum D) oxygen
A) 2.05x1024atoms B) 2.05atoms C) 0.56x10-24atoms D) 18.3atoms
A) 36.4x1023 mol B) 2.70mol C) 185.92mol D) 0.37mol
A) 0.041grams B) 117grams C) 24.67grams D) 222grams
A) Al2Cl3 B) AlCl3 C) AlCl2 D) Al2Cl
A) decomposition B) composition C) single-replacement D) combustion
A) composition B) single-replacement C) double-replacement D) combustion
A) __,3,__,3 B) 3,__,__,3 C) __,3,3,__ D) balanced
A) products B) reactants C) coefficients D) subscripts
A) 138.7grams B) 65.6grams C) 52.0grams D) 39.6grams
A) Li=+1 O=-2 B) Li=+1 O=-1 C) Li=+2 O=-2 D) Li=+2 O=-1
A) 76 amu B) 120 amu C) 76 g/mol D) 120 g/mol
A) 11% B) 89% C) 20% D) 2%
A) 74 amu B) 36 amu C) 74 g/mol D) 36 g/mol
A) decomposition B) single-displacement C) combustion D) double-displacement E) synthesis
A) double-displacement B) single-displacement C) synthesis D) decompostion E) combustion
A) combustion B) decompostion C) synthesis D) single-displacement E) double-displacement
A) combustion B) single-displacement C) synthesis D) double-displacement E) decomposition
A) synthesis B) double-displacement C) decomposition D) single-displacement E) combustion
A) K B) atm C) L D) oC
A) torr B) atm C) L D) K
A) 395cm3 B) 13976cm3 C) 0.047cm3 D) 0.001cm3
A) 1200mmHg B) 1071mmHg C) 706mmHg D) 805mmHg
A) 303K B) 581K C) 855K D) 105.3K
A) 421K B) 500K C) 206K D) 352K
A) 32atm B) 49atm C) 18.9atm D) 15atm
A) Add 273 B) Divide by 273 C) Multiply by 273 D) Subtract 273
A) 101.325kPa B) 760 torr C) All of these D) 1atm
A) oC B) L C) K D) Two of the above
A) experimentation B) communicating results C) organizing data D) research
A) music B) sunlight C) water D) growth
A) growth B) music C) sunlight D) water
A) 86000 B) 860 C) 0.86 D) 8.6
A) homegeneous mixture B) compound C) heterogeneous mixture D) element
A) two of these B) air C) hydrogen D) salt water
A) combine to form new substances B) none of these C) are hard to pick out D) maintain seperate identities
A) physical property B) chemical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) noble gases B) alkali metals C) transition metals D) halogens
A) by atomic number B) alphabetically C) by date of discovery D) by atomic mass
A) Millikan B) Thomson C) Rutherford
A) Thomson B) Millikan C) Rutherford
A) 7 B) 6 C) 9 D) 8
A) Not enough information B) 6.02x1023 C) it depends on the mass
A) 1s22s22p5 B) 1s12s22p5 C) 1s12s12p6 D) 1s22s22p6
A) [Ar]5s2 B) [Kr]5s2 C) [Ar] 4s2 D) [Kr]1s22s22p63s23p64s23d104p65s2
A) decreases B) increases
A) increases B) decreases
A) 12 B) 4 C) 3 D) 6
A) ionic B) metallic C) special D) covalent
A) metallic B) special C) ionic D) covalent
A) MgS4 B) MgS C) MgS2 D) Mg2S
A) CCl4 B) CCl2 C) CCl3 D) CCl
A) iron (II) chloride B) iron dichloride C) iron chloride D) iron (IV) chloride
A) nitrogen hexachloride B) trinitrogen hexachloride C) nitrogen chloride D) nitrogen (III)chloride
A) donates/accepts electrons B) shares electrons
A) number of atoms B) how much it weighs C) charge D) nothing
A) two of these B) transition metals C) 4A D) groups 1A,2A,3A and 4A
A) 3,__,__,3 B) __,3,__,3 C) __,3,3,__ D) __,__,__,__
A) __,__,__,__ B) __,2,__,2 C) __2,2,__ D) 2,__,2,__
A) dividers B) multipliers C) coefficients D) subscripts
A) metalloids B) nonmetals C) metals
A) total protons B) total electrons C) valence electrons D) total neutrons
A) Cr2Cl2 B) CrCl2 C) Cr2Cl D) CrCl
A) HCl B) NaOH C) NaCl D) HF
A) 25 B) 12.5g C) 50 D) 0g
A) neutral B) acids C) bases
A) Ms. Watson B) ... C) ... |