A) 14.28g/cm3 B) 0.014g C) 0.014 g/cm3 D) 14,000 g/cm3
A) somewhat spread apart with almost not movement B) somewhat spread apart with little movement C) very close together and freely moving D) very far apart and feely moving
A) atom with different number of electrons B) atom with different number of protons C) atom with different number of neutrons D) atom with different number of energy levels
A) 5s B) 4p C) 4d D) 3d
A) Si B) S C) Na
A) magnesium B) aluminum C) oxygen D) nitrogen
A) 18.3atoms B) 2.05x1024atoms C) 2.05atoms D) 0.56x10-24atoms
A) 0.37mol B) 36.4x1023 mol C) 2.70mol D) 185.92mol
A) 24.67grams B) 117grams C) 222grams D) 0.041grams
A) Al2Cl B) AlCl3 C) AlCl2 D) Al2Cl3
A) single-replacement B) decomposition C) composition D) combustion
A) single-replacement B) double-replacement C) composition D) combustion
A) __,3,3,__ B) 3,__,__,3 C) __,3,__,3 D) balanced
A) subscripts B) reactants C) products D) coefficients
A) 52.0grams B) 138.7grams C) 39.6grams D) 65.6grams
A) Li=+1 O=-2 B) Li=+1 O=-1 C) Li=+2 O=-1 D) Li=+2 O=-2
A) 120 g/mol B) 120 amu C) 76 g/mol D) 76 amu
A) 89% B) 20% C) 2% D) 11%
A) 36 amu B) 74 g/mol C) 74 amu D) 36 g/mol
A) combustion B) decomposition C) single-displacement D) double-displacement E) synthesis
A) decompostion B) double-displacement C) combustion D) single-displacement E) synthesis
A) double-displacement B) combustion C) single-displacement D) synthesis E) decompostion
A) double-displacement B) decomposition C) combustion D) single-displacement E) synthesis
A) synthesis B) decomposition C) combustion D) double-displacement E) single-displacement
A) L B) atm C) K D) oC
A) atm B) torr C) L D) K
A) 395cm3 B) 0.047cm3 C) 0.001cm3 D) 13976cm3
A) 1071mmHg B) 1200mmHg C) 706mmHg D) 805mmHg
A) 303K B) 581K C) 105.3K D) 855K
A) 500K B) 206K C) 421K D) 352K
A) 18.9atm B) 32atm C) 15atm D) 49atm
A) Divide by 273 B) Add 273 C) Multiply by 273 D) Subtract 273
A) 101.325kPa B) 1atm C) 760 torr D) All of these
A) oC B) Two of the above C) L D) K
A) research B) experimentation C) organizing data D) communicating results
A) growth B) sunlight C) water D) music
A) music B) water C) growth D) sunlight
A) 8.6 B) 860 C) 86000 D) 0.86
A) element B) heterogeneous mixture C) compound D) homegeneous mixture
A) hydrogen B) salt water C) air D) two of these
A) combine to form new substances B) are hard to pick out C) none of these D) maintain seperate identities
A) physical property B) chemical property
A) physical property B) chemical property
A) physical change B) chemical change
A) chemical change B) physical change
A) transition metals B) alkali metals C) halogens D) noble gases
A) by atomic number B) alphabetically C) by atomic mass D) by date of discovery
A) Thomson B) Rutherford C) Millikan
A) Thomson B) Rutherford C) Millikan
A) 9 B) 7 C) 8 D) 6
A) Not enough information B) 6.02x1023 C) it depends on the mass
A) 1s12s22p5 B) 1s22s22p6 C) 1s12s12p6 D) 1s22s22p5
A) [Ar] 4s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Ar]5s2 D) [Kr]5s2
A) decreases B) increases
A) increases B) decreases
A) 12 B) 4 C) 3 D) 6
A) covalent B) special C) metallic D) ionic
A) ionic B) covalent C) special D) metallic
A) MgS4 B) MgS C) MgS2 D) Mg2S
A) CCl4 B) CCl2 C) CCl D) CCl3
A) iron chloride B) iron (II) chloride C) iron dichloride D) iron (IV) chloride
A) nitrogen (III)chloride B) nitrogen chloride C) trinitrogen hexachloride D) nitrogen hexachloride
A) donates/accepts electrons B) shares electrons
A) how much it weighs B) charge C) nothing D) number of atoms
A) 4A B) transition metals C) groups 1A,2A,3A and 4A D) two of these
A) __,3,__,3 B) __,3,3,__ C) 3,__,__,3 D) __,__,__,__
A) __2,2,__ B) __,2,__,2 C) 2,__,2,__ D) __,__,__,__
A) dividers B) subscripts C) coefficients D) multipliers
A) metalloids B) nonmetals C) metals
A) total neutrons B) total protons C) valence electrons D) total electrons
A) Cr2Cl2 B) CrCl2 C) CrCl D) Cr2Cl
A) HF B) NaOH C) HCl D) NaCl
A) 12.5g B) 25 C) 0g D) 50
A) acids B) neutral C) bases
A) ... B) ... C) Ms. Watson |