A) 14.28g/cm3 B) 0.014g C) 14,000 g/cm3 D) 0.014 g/cm3
A) very far apart and feely moving B) somewhat spread apart with almost not movement C) very close together and freely moving D) somewhat spread apart with little movement
A) atom with different number of protons B) atom with different number of energy levels C) atom with different number of neutrons D) atom with different number of electrons
A) 5s B) 4d C) 3d D) 4p
A) Si B) S C) Na
A) aluminum B) nitrogen C) oxygen D) magnesium
A) 0.56x10-24atoms B) 2.05atoms C) 2.05x1024atoms D) 18.3atoms
A) 0.37mol B) 36.4x1023 mol C) 2.70mol D) 185.92mol
A) 24.67grams B) 222grams C) 0.041grams D) 117grams
A) Al2Cl3 B) AlCl2 C) AlCl3 D) Al2Cl
A) decomposition B) combustion C) composition D) single-replacement
A) combustion B) single-replacement C) composition D) double-replacement
A) __,3,__,3 B) balanced C) __,3,3,__ D) 3,__,__,3
A) subscripts B) reactants C) coefficients D) products
A) 52.0grams B) 65.6grams C) 138.7grams D) 39.6grams
A) Li=+2 O=-1 B) Li=+1 O=-2 C) Li=+2 O=-2 D) Li=+1 O=-1
A) 76 g/mol B) 76 amu C) 120 g/mol D) 120 amu
A) 2% B) 89% C) 11% D) 20%
A) 36 g/mol B) 74 g/mol C) 74 amu D) 36 amu
A) single-displacement B) synthesis C) decomposition D) double-displacement E) combustion
A) single-displacement B) double-displacement C) decompostion D) synthesis E) combustion
A) single-displacement B) synthesis C) decompostion D) double-displacement E) combustion
A) combustion B) synthesis C) decomposition D) single-displacement E) double-displacement
A) synthesis B) decomposition C) combustion D) single-displacement E) double-displacement
A) atm B) K C) oC D) L
A) L B) K C) torr D) atm
A) 395cm3 B) 13976cm3 C) 0.047cm3 D) 0.001cm3
A) 805mmHg B) 1071mmHg C) 1200mmHg D) 706mmHg
A) 581K B) 855K C) 105.3K D) 303K
A) 421K B) 352K C) 206K D) 500K
A) 18.9atm B) 32atm C) 49atm D) 15atm
A) Add 273 B) Multiply by 273 C) Divide by 273 D) Subtract 273
A) 760 torr B) All of these C) 101.325kPa D) 1atm
A) K B) L C) oC D) Two of the above
A) organizing data B) experimentation C) communicating results D) research
A) growth B) water C) sunlight D) music
A) sunlight B) music C) growth D) water
A) 0.86 B) 8.6 C) 86000 D) 860
A) element B) heterogeneous mixture C) compound D) homegeneous mixture
A) hydrogen B) two of these C) air D) salt water
A) none of these B) are hard to pick out C) combine to form new substances D) maintain seperate identities
A) chemical property B) physical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) alkali metals B) halogens C) noble gases D) transition metals
A) by atomic number B) by date of discovery C) alphabetically D) by atomic mass
A) Rutherford B) Millikan C) Thomson
A) Rutherford B) Millikan C) Thomson
A) 9 B) 8 C) 7 D) 6
A) it depends on the mass B) Not enough information C) 6.02x1023
A) 1s12s22p5 B) 1s22s22p5 C) 1s22s22p6 D) 1s12s12p6
A) [Ar]5s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Kr]5s2 D) [Ar] 4s2
A) decreases B) increases
A) decreases B) increases
A) 12 B) 3 C) 4 D) 6
A) metallic B) covalent C) ionic D) special
A) ionic B) metallic C) special D) covalent
A) MgS B) MgS4 C) Mg2S D) MgS2
A) CCl B) CCl2 C) CCl4 D) CCl3
A) iron chloride B) iron dichloride C) iron (IV) chloride D) iron (II) chloride
A) nitrogen (III)chloride B) nitrogen hexachloride C) nitrogen chloride D) trinitrogen hexachloride
A) donates/accepts electrons B) shares electrons
A) how much it weighs B) number of atoms C) charge D) nothing
A) two of these B) groups 1A,2A,3A and 4A C) transition metals D) 4A
A) __,__,__,__ B) __,3,3,__ C) 3,__,__,3 D) __,3,__,3
A) __,2,__,2 B) __,__,__,__ C) __2,2,__ D) 2,__,2,__
A) dividers B) multipliers C) subscripts D) coefficients
A) nonmetals B) metalloids C) metals
A) total protons B) total electrons C) total neutrons D) valence electrons
A) CrCl B) CrCl2 C) Cr2Cl2 D) Cr2Cl
A) NaCl B) NaOH C) HCl D) HF
A) 25 B) 50 C) 12.5g D) 0g
A) acids B) neutral C) bases
A) ... B) ... C) Ms. Watson |