A) 0.014g B) 14.28g/cm3 C) 0.014 g/cm3 D) 14,000 g/cm3
A) somewhat spread apart with almost not movement B) very close together and freely moving C) very far apart and feely moving D) somewhat spread apart with little movement
A) atom with different number of neutrons B) atom with different number of electrons C) atom with different number of protons D) atom with different number of energy levels
A) 4p B) 3d C) 4d D) 5s
A) S B) Na C) Si
A) magnesium B) nitrogen C) aluminum D) oxygen
A) 2.05atoms B) 18.3atoms C) 0.56x10-24atoms D) 2.05x1024atoms
A) 185.92mol B) 0.37mol C) 36.4x1023 mol D) 2.70mol
A) 222grams B) 24.67grams C) 117grams D) 0.041grams
A) Al2Cl3 B) AlCl2 C) Al2Cl D) AlCl3
A) combustion B) single-replacement C) decomposition D) composition
A) composition B) combustion C) double-replacement D) single-replacement
A) __,3,__,3 B) 3,__,__,3 C) __,3,3,__ D) balanced
A) reactants B) products C) subscripts D) coefficients
A) 39.6grams B) 138.7grams C) 65.6grams D) 52.0grams
A) Li=+2 O=-1 B) Li=+2 O=-2 C) Li=+1 O=-1 D) Li=+1 O=-2
A) 76 amu B) 120 g/mol C) 76 g/mol D) 120 amu
A) 2% B) 20% C) 11% D) 89%
A) 36 g/mol B) 74 amu C) 36 amu D) 74 g/mol
A) combustion B) double-displacement C) synthesis D) decomposition E) single-displacement
A) double-displacement B) synthesis C) combustion D) decompostion E) single-displacement
A) double-displacement B) decompostion C) synthesis D) combustion E) single-displacement
A) decomposition B) synthesis C) double-displacement D) combustion E) single-displacement
A) single-displacement B) decomposition C) double-displacement D) synthesis E) combustion
A) atm B) K C) oC D) L
A) L B) torr C) K D) atm
A) 13976cm3 B) 0.047cm3 C) 395cm3 D) 0.001cm3
A) 1200mmHg B) 805mmHg C) 706mmHg D) 1071mmHg
A) 105.3K B) 303K C) 855K D) 581K
A) 352K B) 500K C) 421K D) 206K
A) 49atm B) 15atm C) 18.9atm D) 32atm
A) Add 273 B) Multiply by 273 C) Subtract 273 D) Divide by 273
A) 101.325kPa B) 1atm C) All of these D) 760 torr
A) Two of the above B) K C) L D) oC
A) communicating results B) experimentation C) organizing data D) research
A) sunlight B) music C) growth D) water
A) growth B) sunlight C) water D) music
A) 8.6 B) 86000 C) 860 D) 0.86
A) compound B) heterogeneous mixture C) element D) homegeneous mixture
A) salt water B) air C) two of these D) hydrogen
A) are hard to pick out B) combine to form new substances C) none of these D) maintain seperate identities
A) physical property B) chemical property
A) chemical property B) physical property
A) chemical change B) physical change
A) chemical change B) physical change
A) halogens B) noble gases C) transition metals D) alkali metals
A) by atomic mass B) by date of discovery C) by atomic number D) alphabetically
A) Rutherford B) Millikan C) Thomson
A) Rutherford B) Thomson C) Millikan
A) 7 B) 6 C) 9 D) 8
A) 6.02x1023 B) Not enough information C) it depends on the mass
A) 1s12s22p5 B) 1s22s22p5 C) 1s22s22p6 D) 1s12s12p6
A) [Ar] 4s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Ar]5s2 D) [Kr]5s2
A) decreases B) increases
A) increases B) decreases
A) 4 B) 12 C) 3 D) 6
A) metallic B) covalent C) special D) ionic
A) covalent B) ionic C) metallic D) special
A) Mg2S B) MgS4 C) MgS D) MgS2
A) CCl3 B) CCl2 C) CCl4 D) CCl
A) iron (II) chloride B) iron dichloride C) iron (IV) chloride D) iron chloride
A) nitrogen chloride B) nitrogen hexachloride C) nitrogen (III)chloride D) trinitrogen hexachloride
A) donates/accepts electrons B) shares electrons
A) charge B) nothing C) number of atoms D) how much it weighs
A) groups 1A,2A,3A and 4A B) 4A C) transition metals D) two of these
A) 3,__,__,3 B) __,__,__,__ C) __,3,__,3 D) __,3,3,__
A) 2,__,2,__ B) __,__,__,__ C) __,2,__,2 D) __2,2,__
A) dividers B) multipliers C) coefficients D) subscripts
A) nonmetals B) metalloids C) metals
A) valence electrons B) total neutrons C) total electrons D) total protons
A) Cr2Cl2 B) CrCl2 C) CrCl D) Cr2Cl
A) HF B) HCl C) NaCl D) NaOH
A) 25 B) 50 C) 0g D) 12.5g
A) neutral B) acids C) bases
A) ... B) Ms. Watson C) ... |