A) 0.014 g/cm3 B) 14.28g/cm3 C) 14,000 g/cm3 D) 0.014g
A) very close together and freely moving B) somewhat spread apart with almost not movement C) somewhat spread apart with little movement D) very far apart and feely moving
A) atom with different number of energy levels B) atom with different number of protons C) atom with different number of electrons D) atom with different number of neutrons
A) 3d B) 5s C) 4d D) 4p
A) Na B) S C) Si
A) magnesium B) oxygen C) nitrogen D) aluminum
A) 0.56x10-24atoms B) 2.05x1024atoms C) 18.3atoms D) 2.05atoms
A) 0.37mol B) 36.4x1023 mol C) 2.70mol D) 185.92mol
A) 24.67grams B) 0.041grams C) 222grams D) 117grams
A) Al2Cl B) AlCl2 C) Al2Cl3 D) AlCl3
A) single-replacement B) combustion C) composition D) decomposition
A) single-replacement B) double-replacement C) composition D) combustion
A) __,3,3,__ B) balanced C) __,3,__,3 D) 3,__,__,3
A) subscripts B) products C) coefficients D) reactants
A) 52.0grams B) 65.6grams C) 138.7grams D) 39.6grams
A) Li=+2 O=-1 B) Li=+1 O=-2 C) Li=+1 O=-1 D) Li=+2 O=-2
A) 76 amu B) 120 g/mol C) 120 amu D) 76 g/mol
A) 11% B) 20% C) 2% D) 89%
A) 36 amu B) 74 amu C) 36 g/mol D) 74 g/mol
A) single-displacement B) combustion C) decomposition D) synthesis E) double-displacement
A) decompostion B) synthesis C) single-displacement D) combustion E) double-displacement
A) combustion B) double-displacement C) synthesis D) decompostion E) single-displacement
A) double-displacement B) synthesis C) combustion D) decomposition E) single-displacement
A) combustion B) synthesis C) single-displacement D) decomposition E) double-displacement
A) L B) K C) atm D) oC
A) torr B) K C) L D) atm
A) 395cm3 B) 0.047cm3 C) 0.001cm3 D) 13976cm3
A) 1071mmHg B) 706mmHg C) 1200mmHg D) 805mmHg
A) 855K B) 581K C) 105.3K D) 303K
A) 500K B) 206K C) 421K D) 352K
A) 18.9atm B) 32atm C) 49atm D) 15atm
A) Add 273 B) Multiply by 273 C) Divide by 273 D) Subtract 273
A) All of these B) 101.325kPa C) 760 torr D) 1atm
A) L B) oC C) K D) Two of the above
A) organizing data B) research C) experimentation D) communicating results
A) growth B) sunlight C) music D) water
A) sunlight B) growth C) music D) water
A) 860 B) 86000 C) 0.86 D) 8.6
A) compound B) homegeneous mixture C) heterogeneous mixture D) element
A) two of these B) air C) salt water D) hydrogen
A) combine to form new substances B) none of these C) are hard to pick out D) maintain seperate identities
A) chemical property B) physical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) alkali metals B) noble gases C) halogens D) transition metals
A) alphabetically B) by date of discovery C) by atomic number D) by atomic mass
A) Rutherford B) Thomson C) Millikan
A) Rutherford B) Millikan C) Thomson
A) 7 B) 8 C) 9 D) 6
A) 6.02x1023 B) it depends on the mass C) Not enough information
A) 1s22s22p5 B) 1s12s22p5 C) 1s22s22p6 D) 1s12s12p6
A) [Kr]1s22s22p63s23p64s23d104p65s2 B) [Kr]5s2 C) [Ar]5s2 D) [Ar] 4s2
A) decreases B) increases
A) decreases B) increases
A) 12 B) 6 C) 3 D) 4
A) metallic B) covalent C) ionic D) special
A) ionic B) covalent C) special D) metallic
A) Mg2S B) MgS2 C) MgS4 D) MgS
A) CCl4 B) CCl2 C) CCl D) CCl3
A) iron (II) chloride B) iron chloride C) iron dichloride D) iron (IV) chloride
A) trinitrogen hexachloride B) nitrogen (III)chloride C) nitrogen chloride D) nitrogen hexachloride
A) shares electrons B) donates/accepts electrons
A) how much it weighs B) nothing C) charge D) number of atoms
A) transition metals B) 4A C) groups 1A,2A,3A and 4A D) two of these
A) __,__,__,__ B) 3,__,__,3 C) __,3,__,3 D) __,3,3,__
A) __,2,__,2 B) __2,2,__ C) __,__,__,__ D) 2,__,2,__
A) subscripts B) coefficients C) dividers D) multipliers
A) nonmetals B) metals C) metalloids
A) total protons B) total electrons C) valence electrons D) total neutrons
A) CrCl2 B) Cr2Cl C) CrCl D) Cr2Cl2
A) NaCl B) HF C) HCl D) NaOH
A) 12.5g B) 0g C) 50 D) 25
A) neutral B) bases C) acids
A) ... B) ... C) Ms. Watson |