A) 14.28g/cm3 B) 0.014g C) 0.014 g/cm3 D) 14,000 g/cm3
A) somewhat spread apart with little movement B) somewhat spread apart with almost not movement C) very close together and freely moving D) very far apart and feely moving
A) atom with different number of electrons B) atom with different number of protons C) atom with different number of neutrons D) atom with different number of energy levels
A) 4d B) 5s C) 3d D) 4p
A) S B) Si C) Na
A) aluminum B) nitrogen C) oxygen D) magnesium
A) 2.05x1024atoms B) 0.56x10-24atoms C) 2.05atoms D) 18.3atoms
A) 0.37mol B) 36.4x1023 mol C) 2.70mol D) 185.92mol
A) 222grams B) 117grams C) 0.041grams D) 24.67grams
A) Al2Cl3 B) AlCl3 C) Al2Cl D) AlCl2
A) composition B) decomposition C) combustion D) single-replacement
A) single-replacement B) composition C) double-replacement D) combustion
A) balanced B) 3,__,__,3 C) __,3,__,3 D) __,3,3,__
A) coefficients B) reactants C) subscripts D) products
A) 65.6grams B) 52.0grams C) 138.7grams D) 39.6grams
A) Li=+2 O=-2 B) Li=+1 O=-1 C) Li=+2 O=-1 D) Li=+1 O=-2
A) 120 g/mol B) 76 amu C) 120 amu D) 76 g/mol
A) 20% B) 89% C) 2% D) 11%
A) 36 amu B) 74 amu C) 36 g/mol D) 74 g/mol
A) double-displacement B) synthesis C) single-displacement D) combustion E) decomposition
A) double-displacement B) combustion C) single-displacement D) synthesis E) decompostion
A) synthesis B) double-displacement C) single-displacement D) combustion E) decompostion
A) synthesis B) decomposition C) single-displacement D) combustion E) double-displacement
A) combustion B) synthesis C) double-displacement D) decomposition E) single-displacement
A) K B) L C) oC D) atm
A) atm B) torr C) L D) K
A) 0.001cm3 B) 395cm3 C) 13976cm3 D) 0.047cm3
A) 1071mmHg B) 1200mmHg C) 706mmHg D) 805mmHg
A) 105.3K B) 855K C) 581K D) 303K
A) 500K B) 352K C) 206K D) 421K
A) 32atm B) 49atm C) 18.9atm D) 15atm
A) Add 273 B) Divide by 273 C) Subtract 273 D) Multiply by 273
A) 1atm B) All of these C) 101.325kPa D) 760 torr
A) Two of the above B) K C) L D) oC
A) communicating results B) research C) organizing data D) experimentation
A) growth B) music C) sunlight D) water
A) growth B) water C) music D) sunlight
A) 86000 B) 860 C) 0.86 D) 8.6
A) compound B) homegeneous mixture C) heterogeneous mixture D) element
A) salt water B) hydrogen C) two of these D) air
A) are hard to pick out B) none of these C) combine to form new substances D) maintain seperate identities
A) physical property B) chemical property
A) chemical property B) physical property
A) chemical change B) physical change
A) physical change B) chemical change
A) halogens B) noble gases C) alkali metals D) transition metals
A) by date of discovery B) alphabetically C) by atomic mass D) by atomic number
A) Rutherford B) Millikan C) Thomson
A) Thomson B) Millikan C) Rutherford
A) 9 B) 7 C) 6 D) 8
A) it depends on the mass B) Not enough information C) 6.02x1023
A) 1s22s22p6 B) 1s12s22p5 C) 1s12s12p6 D) 1s22s22p5
A) [Kr]5s2 B) [Ar]5s2 C) [Kr]1s22s22p63s23p64s23d104p65s2 D) [Ar] 4s2
A) decreases B) increases
A) increases B) decreases
A) 6 B) 4 C) 12 D) 3
A) ionic B) covalent C) metallic D) special
A) special B) ionic C) covalent D) metallic
A) Mg2S B) MgS C) MgS4 D) MgS2
A) CCl B) CCl2 C) CCl3 D) CCl4
A) iron (IV) chloride B) iron (II) chloride C) iron chloride D) iron dichloride
A) nitrogen (III)chloride B) nitrogen hexachloride C) trinitrogen hexachloride D) nitrogen chloride
A) donates/accepts electrons B) shares electrons
A) how much it weighs B) charge C) number of atoms D) nothing
A) 4A B) two of these C) groups 1A,2A,3A and 4A D) transition metals
A) __,__,__,__ B) __,3,3,__ C) 3,__,__,3 D) __,3,__,3
A) __,2,__,2 B) __2,2,__ C) __,__,__,__ D) 2,__,2,__
A) dividers B) subscripts C) coefficients D) multipliers
A) nonmetals B) metalloids C) metals
A) total protons B) total electrons C) total neutrons D) valence electrons
A) Cr2Cl B) Cr2Cl2 C) CrCl D) CrCl2
A) NaOH B) NaCl C) HF D) HCl
A) 50 B) 25 C) 12.5g D) 0g
A) neutral B) bases C) acids
A) ... B) ... C) Ms. Watson |