A) 0.014 g/cm3 B) 14,000 g/cm3 C) 14.28g/cm3 D) 0.014g
A) somewhat spread apart with little movement B) somewhat spread apart with almost not movement C) very close together and freely moving D) very far apart and feely moving
A) atom with different number of electrons B) atom with different number of protons C) atom with different number of neutrons D) atom with different number of energy levels
A) 4d B) 4p C) 3d D) 5s
A) Si B) Na C) S
A) magnesium B) nitrogen C) oxygen D) aluminum
A) 2.05x1024atoms B) 18.3atoms C) 2.05atoms D) 0.56x10-24atoms
A) 185.92mol B) 0.37mol C) 36.4x1023 mol D) 2.70mol
A) 222grams B) 24.67grams C) 0.041grams D) 117grams
A) Al2Cl B) AlCl2 C) Al2Cl3 D) AlCl3
A) single-replacement B) decomposition C) combustion D) composition
A) composition B) double-replacement C) combustion D) single-replacement
A) __,3,3,__ B) balanced C) __,3,__,3 D) 3,__,__,3
A) subscripts B) products C) coefficients D) reactants
A) 52.0grams B) 39.6grams C) 65.6grams D) 138.7grams
A) Li=+1 O=-1 B) Li=+1 O=-2 C) Li=+2 O=-1 D) Li=+2 O=-2
A) 120 amu B) 120 g/mol C) 76 amu D) 76 g/mol
A) 11% B) 89% C) 20% D) 2%
A) 36 g/mol B) 36 amu C) 74 amu D) 74 g/mol
A) decomposition B) double-displacement C) combustion D) synthesis E) single-displacement
A) double-displacement B) synthesis C) decompostion D) single-displacement E) combustion
A) synthesis B) decompostion C) combustion D) double-displacement E) single-displacement
A) synthesis B) decomposition C) double-displacement D) combustion E) single-displacement
A) synthesis B) double-displacement C) decomposition D) combustion E) single-displacement
A) K B) L C) atm D) oC
A) K B) atm C) torr D) L
A) 13976cm3 B) 0.001cm3 C) 0.047cm3 D) 395cm3
A) 1200mmHg B) 1071mmHg C) 706mmHg D) 805mmHg
A) 581K B) 105.3K C) 303K D) 855K
A) 500K B) 352K C) 206K D) 421K
A) 49atm B) 18.9atm C) 32atm D) 15atm
A) Subtract 273 B) Multiply by 273 C) Divide by 273 D) Add 273
A) 101.325kPa B) 1atm C) 760 torr D) All of these
A) L B) oC C) Two of the above D) K
A) organizing data B) communicating results C) experimentation D) research
A) sunlight B) water C) music D) growth
A) music B) sunlight C) growth D) water
A) 86000 B) 860 C) 8.6 D) 0.86
A) element B) heterogeneous mixture C) homegeneous mixture D) compound
A) air B) salt water C) two of these D) hydrogen
A) combine to form new substances B) maintain seperate identities C) are hard to pick out D) none of these
A) physical property B) chemical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) halogens B) alkali metals C) transition metals D) noble gases
A) by atomic number B) by date of discovery C) alphabetically D) by atomic mass
A) Thomson B) Rutherford C) Millikan
A) Millikan B) Thomson C) Rutherford
A) 9 B) 7 C) 6 D) 8
A) it depends on the mass B) 6.02x1023 C) Not enough information
A) 1s12s22p5 B) 1s12s12p6 C) 1s22s22p6 D) 1s22s22p5
A) [Ar] 4s2 B) [Ar]5s2 C) [Kr]1s22s22p63s23p64s23d104p65s2 D) [Kr]5s2
A) decreases B) increases
A) decreases B) increases
A) 4 B) 12 C) 6 D) 3
A) special B) covalent C) ionic D) metallic
A) covalent B) special C) ionic D) metallic
A) MgS2 B) Mg2S C) MgS4 D) MgS
A) CCl2 B) CCl3 C) CCl4 D) CCl
A) iron (IV) chloride B) iron chloride C) iron (II) chloride D) iron dichloride
A) trinitrogen hexachloride B) nitrogen (III)chloride C) nitrogen chloride D) nitrogen hexachloride
A) shares electrons B) donates/accepts electrons
A) nothing B) charge C) number of atoms D) how much it weighs
A) two of these B) groups 1A,2A,3A and 4A C) 4A D) transition metals
A) __,3,3,__ B) 3,__,__,3 C) __,__,__,__ D) __,3,__,3
A) __2,2,__ B) __,2,__,2 C) 2,__,2,__ D) __,__,__,__
A) subscripts B) multipliers C) coefficients D) dividers
A) metals B) nonmetals C) metalloids
A) total protons B) valence electrons C) total electrons D) total neutrons
A) CrCl2 B) Cr2Cl C) CrCl D) Cr2Cl2
A) NaOH B) HF C) NaCl D) HCl
A) 12.5g B) 25 C) 50 D) 0g
A) acids B) bases C) neutral
A) ... B) Ms. Watson C) ... |