A) 14,000 g/cm3 B) 14.28g/cm3 C) 0.014 g/cm3 D) 0.014g
A) very far apart and feely moving B) somewhat spread apart with almost not movement C) very close together and freely moving D) somewhat spread apart with little movement
A) atom with different number of electrons B) atom with different number of protons C) atom with different number of energy levels D) atom with different number of neutrons
A) 4p B) 4d C) 3d D) 5s
A) Si B) Na C) S
A) aluminum B) nitrogen C) oxygen D) magnesium
A) 2.05x1024atoms B) 0.56x10-24atoms C) 2.05atoms D) 18.3atoms
A) 2.70mol B) 185.92mol C) 36.4x1023 mol D) 0.37mol
A) 24.67grams B) 222grams C) 117grams D) 0.041grams
A) Al2Cl B) AlCl3 C) AlCl2 D) Al2Cl3
A) decomposition B) single-replacement C) composition D) combustion
A) single-replacement B) combustion C) double-replacement D) composition
A) balanced B) __,3,__,3 C) 3,__,__,3 D) __,3,3,__
A) reactants B) subscripts C) coefficients D) products
A) 65.6grams B) 52.0grams C) 39.6grams D) 138.7grams
A) Li=+1 O=-1 B) Li=+1 O=-2 C) Li=+2 O=-1 D) Li=+2 O=-2
A) 76 amu B) 120 g/mol C) 76 g/mol D) 120 amu
A) 2% B) 89% C) 20% D) 11%
A) 36 g/mol B) 74 g/mol C) 36 amu D) 74 amu
A) double-displacement B) combustion C) decomposition D) single-displacement E) synthesis
A) combustion B) double-displacement C) decompostion D) synthesis E) single-displacement
A) decompostion B) combustion C) double-displacement D) single-displacement E) synthesis
A) double-displacement B) combustion C) single-displacement D) synthesis E) decomposition
A) synthesis B) double-displacement C) decomposition D) single-displacement E) combustion
A) atm B) L C) oC D) K
A) K B) torr C) atm D) L
A) 13976cm3 B) 0.001cm3 C) 0.047cm3 D) 395cm3
A) 1200mmHg B) 706mmHg C) 805mmHg D) 1071mmHg
A) 581K B) 303K C) 105.3K D) 855K
A) 421K B) 500K C) 206K D) 352K
A) 49atm B) 15atm C) 32atm D) 18.9atm
A) Divide by 273 B) Add 273 C) Subtract 273 D) Multiply by 273
A) 760 torr B) 1atm C) 101.325kPa D) All of these
A) K B) oC C) L D) Two of the above
A) communicating results B) research C) organizing data D) experimentation
A) sunlight B) growth C) music D) water
A) sunlight B) growth C) music D) water
A) 0.86 B) 86000 C) 8.6 D) 860
A) compound B) homegeneous mixture C) element D) heterogeneous mixture
A) salt water B) hydrogen C) air D) two of these
A) none of these B) maintain seperate identities C) are hard to pick out D) combine to form new substances
A) physical property B) chemical property
A) chemical property B) physical property
A) physical change B) chemical change
A) chemical change B) physical change
A) alkali metals B) noble gases C) transition metals D) halogens
A) by date of discovery B) by atomic mass C) by atomic number D) alphabetically
A) Millikan B) Rutherford C) Thomson
A) Millikan B) Thomson C) Rutherford
A) 6 B) 7 C) 8 D) 9
A) 6.02x1023 B) it depends on the mass C) Not enough information
A) 1s22s22p5 B) 1s12s22p5 C) 1s22s22p6 D) 1s12s12p6
A) [Ar] 4s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Kr]5s2 D) [Ar]5s2
A) decreases B) increases
A) increases B) decreases
A) 3 B) 4 C) 12 D) 6
A) ionic B) covalent C) special D) metallic
A) covalent B) metallic C) special D) ionic
A) Mg2S B) MgS C) MgS4 D) MgS2
A) CCl2 B) CCl C) CCl4 D) CCl3
A) iron (II) chloride B) iron (IV) chloride C) iron chloride D) iron dichloride
A) trinitrogen hexachloride B) nitrogen (III)chloride C) nitrogen hexachloride D) nitrogen chloride
A) shares electrons B) donates/accepts electrons
A) charge B) how much it weighs C) number of atoms D) nothing
A) groups 1A,2A,3A and 4A B) 4A C) transition metals D) two of these
A) __,3,3,__ B) __,__,__,__ C) __,3,__,3 D) 3,__,__,3
A) __,__,__,__ B) 2,__,2,__ C) __2,2,__ D) __,2,__,2
A) coefficients B) subscripts C) dividers D) multipliers
A) nonmetals B) metalloids C) metals
A) total electrons B) total protons C) total neutrons D) valence electrons
A) CrCl2 B) Cr2Cl C) Cr2Cl2 D) CrCl
A) NaCl B) HF C) NaOH D) HCl
A) 12.5g B) 50 C) 25 D) 0g
A) neutral B) acids C) bases
A) Ms. Watson B) ... C) ... |