A) 0.014g B) 0.014 g/cm3 C) 14.28g/cm3 D) 14,000 g/cm3
A) somewhat spread apart with little movement B) very far apart and feely moving C) somewhat spread apart with almost not movement D) very close together and freely moving
A) atom with different number of protons B) atom with different number of neutrons C) atom with different number of energy levels D) atom with different number of electrons
A) 4d B) 5s C) 4p D) 3d
A) Si B) Na C) S
A) magnesium B) aluminum C) oxygen D) nitrogen
A) 2.05atoms B) 0.56x10-24atoms C) 18.3atoms D) 2.05x1024atoms
A) 185.92mol B) 0.37mol C) 2.70mol D) 36.4x1023 mol
A) 117grams B) 222grams C) 24.67grams D) 0.041grams
A) AlCl2 B) AlCl3 C) Al2Cl D) Al2Cl3
A) composition B) decomposition C) single-replacement D) combustion
A) composition B) single-replacement C) combustion D) double-replacement
A) __,3,3,__ B) __,3,__,3 C) 3,__,__,3 D) balanced
A) products B) reactants C) subscripts D) coefficients
A) 138.7grams B) 65.6grams C) 39.6grams D) 52.0grams
A) Li=+1 O=-2 B) Li=+2 O=-2 C) Li=+2 O=-1 D) Li=+1 O=-1
A) 120 g/mol B) 120 amu C) 76 amu D) 76 g/mol
A) 20% B) 11% C) 2% D) 89%
A) 74 g/mol B) 36 g/mol C) 74 amu D) 36 amu
A) synthesis B) combustion C) decomposition D) single-displacement E) double-displacement
A) double-displacement B) combustion C) single-displacement D) decompostion E) synthesis
A) synthesis B) double-displacement C) single-displacement D) decompostion E) combustion
A) synthesis B) single-displacement C) decomposition D) double-displacement E) combustion
A) combustion B) synthesis C) decomposition D) single-displacement E) double-displacement
A) oC B) L C) K D) atm
A) torr B) L C) atm D) K
A) 395cm3 B) 0.001cm3 C) 13976cm3 D) 0.047cm3
A) 1200mmHg B) 1071mmHg C) 805mmHg D) 706mmHg
A) 303K B) 855K C) 105.3K D) 581K
A) 206K B) 421K C) 500K D) 352K
A) 49atm B) 18.9atm C) 15atm D) 32atm
A) Subtract 273 B) Add 273 C) Multiply by 273 D) Divide by 273
A) 1atm B) 101.325kPa C) All of these D) 760 torr
A) oC B) K C) Two of the above D) L
A) experimentation B) research C) communicating results D) organizing data
A) growth B) music C) water D) sunlight
A) water B) sunlight C) growth D) music
A) 860 B) 86000 C) 0.86 D) 8.6
A) homegeneous mixture B) compound C) heterogeneous mixture D) element
A) hydrogen B) salt water C) air D) two of these
A) none of these B) maintain seperate identities C) combine to form new substances D) are hard to pick out
A) physical property B) chemical property
A) chemical property B) physical property
A) chemical change B) physical change
A) physical change B) chemical change
A) transition metals B) noble gases C) alkali metals D) halogens
A) by atomic number B) by atomic mass C) alphabetically D) by date of discovery
A) Rutherford B) Millikan C) Thomson
A) Millikan B) Thomson C) Rutherford
A) 8 B) 9 C) 7 D) 6
A) it depends on the mass B) Not enough information C) 6.02x1023
A) 1s12s12p6 B) 1s22s22p5 C) 1s12s22p5 D) 1s22s22p6
A) [Ar]5s2 B) [Ar] 4s2 C) [Kr]1s22s22p63s23p64s23d104p65s2 D) [Kr]5s2
A) increases B) decreases
A) increases B) decreases
A) 4 B) 12 C) 6 D) 3
A) special B) covalent C) metallic D) ionic
A) metallic B) covalent C) ionic D) special
A) MgS4 B) MgS2 C) MgS D) Mg2S
A) CCl B) CCl4 C) CCl3 D) CCl2
A) iron (IV) chloride B) iron chloride C) iron dichloride D) iron (II) chloride
A) nitrogen (III)chloride B) nitrogen chloride C) nitrogen hexachloride D) trinitrogen hexachloride
A) shares electrons B) donates/accepts electrons
A) charge B) number of atoms C) nothing D) how much it weighs
A) transition metals B) two of these C) 4A D) groups 1A,2A,3A and 4A
A) __,3,3,__ B) __,__,__,__ C) __,3,__,3 D) 3,__,__,3
A) __,__,__,__ B) 2,__,2,__ C) __2,2,__ D) __,2,__,2
A) dividers B) coefficients C) subscripts D) multipliers
A) nonmetals B) metalloids C) metals
A) total protons B) total electrons C) valence electrons D) total neutrons
A) Cr2Cl2 B) Cr2Cl C) CrCl2 D) CrCl
A) HCl B) NaCl C) HF D) NaOH
A) 0g B) 50 C) 12.5g D) 25
A) bases B) acids C) neutral
A) ... B) Ms. Watson C) ... |