A) 0.014 g/cm3 B) 0.014g C) 14.28g/cm3 D) 14,000 g/cm3
A) very close together and freely moving B) very far apart and feely moving C) somewhat spread apart with little movement D) somewhat spread apart with almost not movement
A) atom with different number of neutrons B) atom with different number of electrons C) atom with different number of protons D) atom with different number of energy levels
A) 4d B) 4p C) 5s D) 3d
A) Si B) S C) Na
A) oxygen B) nitrogen C) magnesium D) aluminum
A) 18.3atoms B) 2.05atoms C) 0.56x10-24atoms D) 2.05x1024atoms
A) 36.4x1023 mol B) 2.70mol C) 0.37mol D) 185.92mol
A) 24.67grams B) 0.041grams C) 222grams D) 117grams
A) Al2Cl3 B) Al2Cl C) AlCl2 D) AlCl3
A) combustion B) composition C) single-replacement D) decomposition
A) combustion B) single-replacement C) composition D) double-replacement
A) __,3,__,3 B) balanced C) __,3,3,__ D) 3,__,__,3
A) coefficients B) products C) reactants D) subscripts
A) 138.7grams B) 52.0grams C) 39.6grams D) 65.6grams
A) Li=+2 O=-1 B) Li=+2 O=-2 C) Li=+1 O=-1 D) Li=+1 O=-2
A) 120 amu B) 120 g/mol C) 76 g/mol D) 76 amu
A) 11% B) 20% C) 89% D) 2%
A) 36 amu B) 74 amu C) 74 g/mol D) 36 g/mol
A) decomposition B) combustion C) single-displacement D) synthesis E) double-displacement
A) single-displacement B) double-displacement C) decompostion D) combustion E) synthesis
A) decompostion B) double-displacement C) combustion D) single-displacement E) synthesis
A) decomposition B) double-displacement C) single-displacement D) synthesis E) combustion
A) single-displacement B) double-displacement C) decomposition D) combustion E) synthesis
A) K B) L C) atm D) oC
A) K B) torr C) L D) atm
A) 0.047cm3 B) 0.001cm3 C) 395cm3 D) 13976cm3
A) 706mmHg B) 1200mmHg C) 805mmHg D) 1071mmHg
A) 303K B) 855K C) 581K D) 105.3K
A) 352K B) 421K C) 500K D) 206K
A) 49atm B) 15atm C) 32atm D) 18.9atm
A) Divide by 273 B) Multiply by 273 C) Subtract 273 D) Add 273
A) 760 torr B) 101.325kPa C) All of these D) 1atm
A) oC B) K C) L D) Two of the above
A) organizing data B) communicating results C) research D) experimentation
A) music B) water C) sunlight D) growth
A) water B) growth C) sunlight D) music
A) 860 B) 8.6 C) 0.86 D) 86000
A) element B) compound C) homegeneous mixture D) heterogeneous mixture
A) two of these B) air C) hydrogen D) salt water
A) combine to form new substances B) are hard to pick out C) none of these D) maintain seperate identities
A) chemical property B) physical property
A) physical property B) chemical property
A) physical change B) chemical change
A) physical change B) chemical change
A) alkali metals B) noble gases C) halogens D) transition metals
A) by atomic mass B) by atomic number C) by date of discovery D) alphabetically
A) Rutherford B) Thomson C) Millikan
A) Thomson B) Millikan C) Rutherford
A) 8 B) 7 C) 9 D) 6
A) Not enough information B) it depends on the mass C) 6.02x1023
A) 1s12s22p5 B) 1s12s12p6 C) 1s22s22p5 D) 1s22s22p6
A) [Kr]5s2 B) [Ar]5s2 C) [Kr]1s22s22p63s23p64s23d104p65s2 D) [Ar] 4s2
A) decreases B) increases
A) increases B) decreases
A) 4 B) 6 C) 3 D) 12
A) ionic B) metallic C) covalent D) special
A) metallic B) ionic C) covalent D) special
A) MgS2 B) MgS C) Mg2S D) MgS4
A) CCl4 B) CCl3 C) CCl2 D) CCl
A) iron dichloride B) iron (IV) chloride C) iron (II) chloride D) iron chloride
A) nitrogen chloride B) nitrogen hexachloride C) trinitrogen hexachloride D) nitrogen (III)chloride
A) donates/accepts electrons B) shares electrons
A) nothing B) charge C) number of atoms D) how much it weighs
A) 4A B) groups 1A,2A,3A and 4A C) two of these D) transition metals
A) 3,__,__,3 B) __,3,__,3 C) __,__,__,__ D) __,3,3,__
A) __,2,__,2 B) __,__,__,__ C) 2,__,2,__ D) __2,2,__
A) coefficients B) multipliers C) dividers D) subscripts
A) metals B) nonmetals C) metalloids
A) total electrons B) total protons C) valence electrons D) total neutrons
A) Cr2Cl B) CrCl C) Cr2Cl2 D) CrCl2
A) NaOH B) HCl C) NaCl D) HF
A) 50 B) 25 C) 0g D) 12.5g
A) neutral B) acids C) bases
A) ... B) ... C) Ms. Watson |