A) 0.014g B) 14,000 g/cm3 C) 14.28g/cm3 D) 0.014 g/cm3
A) somewhat spread apart with little movement B) very far apart and feely moving C) very close together and freely moving D) somewhat spread apart with almost not movement
A) atom with different number of protons B) atom with different number of neutrons C) atom with different number of electrons D) atom with different number of energy levels
A) 3d B) 5s C) 4p D) 4d
A) S B) Si C) Na
A) aluminum B) nitrogen C) oxygen D) magnesium
A) 2.05atoms B) 18.3atoms C) 2.05x1024atoms D) 0.56x10-24atoms
A) 0.37mol B) 2.70mol C) 185.92mol D) 36.4x1023 mol
A) 222grams B) 0.041grams C) 117grams D) 24.67grams
A) AlCl3 B) Al2Cl C) Al2Cl3 D) AlCl2
A) composition B) decomposition C) combustion D) single-replacement
A) single-replacement B) combustion C) composition D) double-replacement
A) __,3,__,3 B) __,3,3,__ C) balanced D) 3,__,__,3
A) subscripts B) coefficients C) reactants D) products
A) 39.6grams B) 52.0grams C) 65.6grams D) 138.7grams
A) Li=+1 O=-1 B) Li=+2 O=-1 C) Li=+1 O=-2 D) Li=+2 O=-2
A) 120 g/mol B) 120 amu C) 76 amu D) 76 g/mol
A) 89% B) 2% C) 20% D) 11%
A) 74 g/mol B) 74 amu C) 36 amu D) 36 g/mol
A) synthesis B) double-displacement C) decomposition D) combustion E) single-displacement
A) double-displacement B) decompostion C) single-displacement D) synthesis E) combustion
A) synthesis B) single-displacement C) double-displacement D) combustion E) decompostion
A) combustion B) decomposition C) single-displacement D) synthesis E) double-displacement
A) double-displacement B) combustion C) decomposition D) synthesis E) single-displacement
A) oC B) L C) atm D) K
A) torr B) L C) atm D) K
A) 0.001cm3 B) 395cm3 C) 0.047cm3 D) 13976cm3
A) 1200mmHg B) 1071mmHg C) 706mmHg D) 805mmHg
A) 855K B) 105.3K C) 303K D) 581K
A) 206K B) 352K C) 421K D) 500K
A) 15atm B) 32atm C) 18.9atm D) 49atm
A) Multiply by 273 B) Subtract 273 C) Add 273 D) Divide by 273
A) 1atm B) 760 torr C) 101.325kPa D) All of these
A) Two of the above B) oC C) K D) L
A) communicating results B) experimentation C) organizing data D) research
A) music B) sunlight C) growth D) water
A) water B) growth C) sunlight D) music
A) 86000 B) 8.6 C) 860 D) 0.86
A) compound B) heterogeneous mixture C) element D) homegeneous mixture
A) hydrogen B) air C) salt water D) two of these
A) maintain seperate identities B) are hard to pick out C) combine to form new substances D) none of these
A) chemical property B) physical property
A) chemical property B) physical property
A) chemical change B) physical change
A) physical change B) chemical change
A) alkali metals B) transition metals C) noble gases D) halogens
A) by date of discovery B) by atomic number C) alphabetically D) by atomic mass
A) Thomson B) Millikan C) Rutherford
A) Millikan B) Thomson C) Rutherford
A) 8 B) 9 C) 6 D) 7
A) 6.02x1023 B) Not enough information C) it depends on the mass
A) 1s22s22p6 B) 1s22s22p5 C) 1s12s22p5 D) 1s12s12p6
A) [Ar]5s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Kr]5s2 D) [Ar] 4s2
A) decreases B) increases
A) increases B) decreases
A) 3 B) 6 C) 12 D) 4
A) special B) ionic C) metallic D) covalent
A) metallic B) ionic C) special D) covalent
A) MgS2 B) MgS C) Mg2S D) MgS4
A) CCl4 B) CCl C) CCl3 D) CCl2
A) iron chloride B) iron dichloride C) iron (IV) chloride D) iron (II) chloride
A) nitrogen (III)chloride B) nitrogen chloride C) nitrogen hexachloride D) trinitrogen hexachloride
A) shares electrons B) donates/accepts electrons
A) number of atoms B) charge C) nothing D) how much it weighs
A) groups 1A,2A,3A and 4A B) two of these C) 4A D) transition metals
A) __,__,__,__ B) __,3,__,3 C) 3,__,__,3 D) __,3,3,__
A) __2,2,__ B) __,__,__,__ C) __,2,__,2 D) 2,__,2,__
A) subscripts B) coefficients C) multipliers D) dividers
A) metals B) nonmetals C) metalloids
A) total protons B) total neutrons C) valence electrons D) total electrons
A) CrCl B) CrCl2 C) Cr2Cl2 D) Cr2Cl
A) NaOH B) HCl C) NaCl D) HF
A) 50 B) 12.5g C) 25 D) 0g
A) bases B) neutral C) acids
A) Ms. Watson B) ... C) ... |