A) 0.014 g/cm3 B) 14.28g/cm3 C) 14,000 g/cm3 D) 0.014g
A) very far apart and feely moving B) somewhat spread apart with little movement C) somewhat spread apart with almost not movement D) very close together and freely moving
A) atom with different number of energy levels B) atom with different number of neutrons C) atom with different number of protons D) atom with different number of electrons
A) 3d B) 4p C) 5s D) 4d
A) S B) Na C) Si
A) magnesium B) oxygen C) aluminum D) nitrogen
A) 18.3atoms B) 0.56x10-24atoms C) 2.05x1024atoms D) 2.05atoms
A) 2.70mol B) 36.4x1023 mol C) 185.92mol D) 0.37mol
A) 24.67grams B) 222grams C) 0.041grams D) 117grams
A) Al2Cl B) Al2Cl3 C) AlCl3 D) AlCl2
A) single-replacement B) composition C) decomposition D) combustion
A) double-replacement B) combustion C) composition D) single-replacement
A) __,3,__,3 B) __,3,3,__ C) balanced D) 3,__,__,3
A) coefficients B) reactants C) products D) subscripts
A) 138.7grams B) 65.6grams C) 52.0grams D) 39.6grams
A) Li=+1 O=-1 B) Li=+1 O=-2 C) Li=+2 O=-2 D) Li=+2 O=-1
A) 76 g/mol B) 120 g/mol C) 120 amu D) 76 amu
A) 2% B) 11% C) 20% D) 89%
A) 36 amu B) 74 g/mol C) 36 g/mol D) 74 amu
A) combustion B) decomposition C) synthesis D) double-displacement E) single-displacement
A) combustion B) double-displacement C) decompostion D) single-displacement E) synthesis
A) combustion B) double-displacement C) synthesis D) decompostion E) single-displacement
A) single-displacement B) decomposition C) double-displacement D) combustion E) synthesis
A) synthesis B) decomposition C) combustion D) double-displacement E) single-displacement
A) atm B) K C) oC D) L
A) K B) atm C) L D) torr
A) 395cm3 B) 0.047cm3 C) 0.001cm3 D) 13976cm3
A) 1200mmHg B) 1071mmHg C) 706mmHg D) 805mmHg
A) 105.3K B) 855K C) 581K D) 303K
A) 352K B) 206K C) 500K D) 421K
A) 32atm B) 49atm C) 15atm D) 18.9atm
A) Add 273 B) Multiply by 273 C) Subtract 273 D) Divide by 273
A) 1atm B) All of these C) 760 torr D) 101.325kPa
A) L B) K C) oC D) Two of the above
A) organizing data B) experimentation C) research D) communicating results
A) water B) music C) sunlight D) growth
A) water B) sunlight C) growth D) music
A) 86000 B) 8.6 C) 0.86 D) 860
A) element B) heterogeneous mixture C) compound D) homegeneous mixture
A) two of these B) hydrogen C) salt water D) air
A) maintain seperate identities B) none of these C) are hard to pick out D) combine to form new substances
A) chemical property B) physical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) halogens B) alkali metals C) noble gases D) transition metals
A) by atomic number B) by date of discovery C) by atomic mass D) alphabetically
A) Thomson B) Rutherford C) Millikan
A) Thomson B) Rutherford C) Millikan
A) 6 B) 9 C) 7 D) 8
A) Not enough information B) 6.02x1023 C) it depends on the mass
A) 1s12s12p6 B) 1s12s22p5 C) 1s22s22p6 D) 1s22s22p5
A) [Kr]1s22s22p63s23p64s23d104p65s2 B) [Ar]5s2 C) [Ar] 4s2 D) [Kr]5s2
A) decreases B) increases
A) increases B) decreases
A) 6 B) 12 C) 3 D) 4
A) metallic B) ionic C) covalent D) special
A) special B) covalent C) ionic D) metallic
A) Mg2S B) MgS4 C) MgS D) MgS2
A) CCl4 B) CCl2 C) CCl D) CCl3
A) iron (II) chloride B) iron dichloride C) iron (IV) chloride D) iron chloride
A) trinitrogen hexachloride B) nitrogen hexachloride C) nitrogen chloride D) nitrogen (III)chloride
A) shares electrons B) donates/accepts electrons
A) charge B) nothing C) how much it weighs D) number of atoms
A) two of these B) groups 1A,2A,3A and 4A C) transition metals D) 4A
A) __,3,__,3 B) 3,__,__,3 C) __,__,__,__ D) __,3,3,__
A) __2,2,__ B) __,__,__,__ C) __,2,__,2 D) 2,__,2,__
A) multipliers B) subscripts C) dividers D) coefficients
A) nonmetals B) metalloids C) metals
A) total neutrons B) total protons C) total electrons D) valence electrons
A) Cr2Cl2 B) CrCl2 C) CrCl D) Cr2Cl
A) NaOH B) HCl C) HF D) NaCl
A) 0g B) 50 C) 12.5g D) 25
A) acids B) neutral C) bases
A) ... B) ... C) Ms. Watson |