A) 14,000 g/cm3 B) 14.28g/cm3 C) 0.014g D) 0.014 g/cm3
A) somewhat spread apart with little movement B) somewhat spread apart with almost not movement C) very close together and freely moving D) very far apart and feely moving
A) atom with different number of energy levels B) atom with different number of neutrons C) atom with different number of protons D) atom with different number of electrons
A) 4d B) 4p C) 5s D) 3d
A) Na B) Si C) S
A) aluminum B) magnesium C) nitrogen D) oxygen
A) 2.05x1024atoms B) 0.56x10-24atoms C) 18.3atoms D) 2.05atoms
A) 0.37mol B) 36.4x1023 mol C) 2.70mol D) 185.92mol
A) 0.041grams B) 117grams C) 222grams D) 24.67grams
A) Al2Cl3 B) Al2Cl C) AlCl2 D) AlCl3
A) composition B) single-replacement C) decomposition D) combustion
A) combustion B) single-replacement C) double-replacement D) composition
A) 3,__,__,3 B) balanced C) __,3,3,__ D) __,3,__,3
A) subscripts B) reactants C) coefficients D) products
A) 52.0grams B) 39.6grams C) 138.7grams D) 65.6grams
A) Li=+2 O=-1 B) Li=+1 O=-2 C) Li=+1 O=-1 D) Li=+2 O=-2
A) 76 g/mol B) 120 g/mol C) 120 amu D) 76 amu
A) 20% B) 89% C) 11% D) 2%
A) 36 g/mol B) 36 amu C) 74 g/mol D) 74 amu
A) double-displacement B) synthesis C) combustion D) decomposition E) single-displacement
A) synthesis B) single-displacement C) decompostion D) double-displacement E) combustion
A) combustion B) synthesis C) single-displacement D) decompostion E) double-displacement
A) decomposition B) single-displacement C) combustion D) double-displacement E) synthesis
A) synthesis B) single-displacement C) double-displacement D) decomposition E) combustion
A) atm B) K C) oC D) L
A) K B) torr C) atm D) L
A) 0.001cm3 B) 395cm3 C) 0.047cm3 D) 13976cm3
A) 1071mmHg B) 706mmHg C) 1200mmHg D) 805mmHg
A) 105.3K B) 581K C) 855K D) 303K
A) 206K B) 500K C) 421K D) 352K
A) 15atm B) 32atm C) 18.9atm D) 49atm
A) Add 273 B) Divide by 273 C) Subtract 273 D) Multiply by 273
A) 101.325kPa B) 1atm C) All of these D) 760 torr
A) oC B) K C) L D) Two of the above
A) research B) communicating results C) experimentation D) organizing data
A) sunlight B) water C) growth D) music
A) sunlight B) water C) growth D) music
A) 86000 B) 0.86 C) 8.6 D) 860
A) compound B) element C) homegeneous mixture D) heterogeneous mixture
A) salt water B) hydrogen C) two of these D) air
A) none of these B) maintain seperate identities C) are hard to pick out D) combine to form new substances
A) physical property B) chemical property
A) chemical property B) physical property
A) physical change B) chemical change
A) physical change B) chemical change
A) noble gases B) alkali metals C) transition metals D) halogens
A) by atomic number B) by atomic mass C) alphabetically D) by date of discovery
A) Thomson B) Millikan C) Rutherford
A) Rutherford B) Thomson C) Millikan
A) 7 B) 6 C) 9 D) 8
A) 6.02x1023 B) it depends on the mass C) Not enough information
A) 1s22s22p6 B) 1s12s22p5 C) 1s12s12p6 D) 1s22s22p5
A) [Kr]1s22s22p63s23p64s23d104p65s2 B) [Kr]5s2 C) [Ar]5s2 D) [Ar] 4s2
A) increases B) decreases
A) decreases B) increases
A) 3 B) 12 C) 6 D) 4
A) covalent B) special C) metallic D) ionic
A) metallic B) special C) ionic D) covalent
A) MgS4 B) Mg2S C) MgS2 D) MgS
A) CCl3 B) CCl4 C) CCl2 D) CCl
A) iron (II) chloride B) iron (IV) chloride C) iron dichloride D) iron chloride
A) nitrogen chloride B) nitrogen hexachloride C) trinitrogen hexachloride D) nitrogen (III)chloride
A) donates/accepts electrons B) shares electrons
A) number of atoms B) nothing C) how much it weighs D) charge
A) groups 1A,2A,3A and 4A B) 4A C) two of these D) transition metals
A) __,3,3,__ B) __,3,__,3 C) 3,__,__,3 D) __,__,__,__
A) 2,__,2,__ B) __2,2,__ C) __,2,__,2 D) __,__,__,__
A) coefficients B) multipliers C) dividers D) subscripts
A) nonmetals B) metalloids C) metals
A) total protons B) total electrons C) total neutrons D) valence electrons
A) Cr2Cl B) Cr2Cl2 C) CrCl D) CrCl2
A) HF B) NaOH C) HCl D) NaCl
A) 50 B) 12.5g C) 25 D) 0g
A) acids B) bases C) neutral
A) ... B) ... C) Ms. Watson |