A) 0.014 g/cm3 B) 14.28g/cm3 C) 0.014g D) 14,000 g/cm3
A) somewhat spread apart with little movement B) somewhat spread apart with almost not movement C) very close together and freely moving D) very far apart and feely moving
A) atom with different number of electrons B) atom with different number of neutrons C) atom with different number of protons D) atom with different number of energy levels
A) 5s B) 3d C) 4d D) 4p
A) Si B) S C) Na
A) oxygen B) aluminum C) nitrogen D) magnesium
A) 0.56x10-24atoms B) 2.05x1024atoms C) 2.05atoms D) 18.3atoms
A) 2.70mol B) 185.92mol C) 0.37mol D) 36.4x1023 mol
A) 24.67grams B) 222grams C) 0.041grams D) 117grams
A) AlCl2 B) AlCl3 C) Al2Cl D) Al2Cl3
A) composition B) combustion C) decomposition D) single-replacement
A) composition B) double-replacement C) single-replacement D) combustion
A) balanced B) __,3,__,3 C) __,3,3,__ D) 3,__,__,3
A) products B) coefficients C) subscripts D) reactants
A) 52.0grams B) 138.7grams C) 65.6grams D) 39.6grams
A) Li=+1 O=-2 B) Li=+1 O=-1 C) Li=+2 O=-1 D) Li=+2 O=-2
A) 120 g/mol B) 76 g/mol C) 120 amu D) 76 amu
A) 11% B) 20% C) 2% D) 89%
A) 36 g/mol B) 36 amu C) 74 g/mol D) 74 amu
A) double-displacement B) decomposition C) single-displacement D) synthesis E) combustion
A) single-displacement B) double-displacement C) combustion D) synthesis E) decompostion
A) single-displacement B) double-displacement C) decompostion D) synthesis E) combustion
A) single-displacement B) decomposition C) double-displacement D) synthesis E) combustion
A) combustion B) double-displacement C) single-displacement D) decomposition E) synthesis
A) K B) L C) atm D) oC
A) torr B) K C) L D) atm
A) 0.001cm3 B) 0.047cm3 C) 13976cm3 D) 395cm3
A) 1071mmHg B) 706mmHg C) 1200mmHg D) 805mmHg
A) 855K B) 303K C) 581K D) 105.3K
A) 352K B) 500K C) 421K D) 206K
A) 15atm B) 49atm C) 32atm D) 18.9atm
A) Add 273 B) Multiply by 273 C) Divide by 273 D) Subtract 273
A) 760 torr B) All of these C) 1atm D) 101.325kPa
A) Two of the above B) L C) oC D) K
A) research B) experimentation C) organizing data D) communicating results
A) water B) growth C) music D) sunlight
A) sunlight B) growth C) music D) water
A) 86000 B) 0.86 C) 8.6 D) 860
A) compound B) element C) heterogeneous mixture D) homegeneous mixture
A) two of these B) air C) hydrogen D) salt water
A) none of these B) combine to form new substances C) maintain seperate identities D) are hard to pick out
A) chemical property B) physical property
A) chemical property B) physical property
A) chemical change B) physical change
A) physical change B) chemical change
A) transition metals B) alkali metals C) halogens D) noble gases
A) alphabetically B) by date of discovery C) by atomic mass D) by atomic number
A) Millikan B) Rutherford C) Thomson
A) Thomson B) Rutherford C) Millikan
A) 9 B) 8 C) 7 D) 6
A) 6.02x1023 B) it depends on the mass C) Not enough information
A) 1s12s12p6 B) 1s22s22p6 C) 1s22s22p5 D) 1s12s22p5
A) [Ar]5s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Ar] 4s2 D) [Kr]5s2
A) increases B) decreases
A) increases B) decreases
A) 12 B) 3 C) 4 D) 6
A) ionic B) metallic C) special D) covalent
A) special B) ionic C) metallic D) covalent
A) MgS B) MgS4 C) MgS2 D) Mg2S
A) CCl3 B) CCl4 C) CCl2 D) CCl
A) iron dichloride B) iron (IV) chloride C) iron chloride D) iron (II) chloride
A) nitrogen hexachloride B) nitrogen (III)chloride C) trinitrogen hexachloride D) nitrogen chloride
A) donates/accepts electrons B) shares electrons
A) charge B) how much it weighs C) number of atoms D) nothing
A) two of these B) 4A C) transition metals D) groups 1A,2A,3A and 4A
A) __,3,__,3 B) __,__,__,__ C) __,3,3,__ D) 3,__,__,3
A) __2,2,__ B) __,2,__,2 C) __,__,__,__ D) 2,__,2,__
A) multipliers B) dividers C) coefficients D) subscripts
A) metalloids B) metals C) nonmetals
A) total protons B) total electrons C) valence electrons D) total neutrons
A) CrCl B) Cr2Cl C) Cr2Cl2 D) CrCl2
A) HCl B) NaCl C) HF D) NaOH
A) 12.5g B) 25 C) 0g D) 50
A) bases B) acids C) neutral
A) Ms. Watson B) ... C) ... |