A) 0.014 g/cm3 B) 14,000 g/cm3 C) 14.28g/cm3 D) 0.014g
A) somewhat spread apart with almost not movement B) very close together and freely moving C) somewhat spread apart with little movement D) very far apart and feely moving
A) atom with different number of electrons B) atom with different number of energy levels C) atom with different number of neutrons D) atom with different number of protons
A) 4d B) 5s C) 4p D) 3d
A) Na B) S C) Si
A) nitrogen B) aluminum C) magnesium D) oxygen
A) 0.56x10-24atoms B) 18.3atoms C) 2.05atoms D) 2.05x1024atoms
A) 0.37mol B) 36.4x1023 mol C) 185.92mol D) 2.70mol
A) 222grams B) 0.041grams C) 117grams D) 24.67grams
A) AlCl2 B) Al2Cl C) Al2Cl3 D) AlCl3
A) combustion B) single-replacement C) composition D) decomposition
A) double-replacement B) single-replacement C) composition D) combustion
A) 3,__,__,3 B) __,3,__,3 C) __,3,3,__ D) balanced
A) reactants B) subscripts C) products D) coefficients
A) 65.6grams B) 39.6grams C) 52.0grams D) 138.7grams
A) Li=+1 O=-1 B) Li=+2 O=-1 C) Li=+1 O=-2 D) Li=+2 O=-2
A) 120 amu B) 120 g/mol C) 76 g/mol D) 76 amu
A) 89% B) 2% C) 20% D) 11%
A) 36 g/mol B) 36 amu C) 74 g/mol D) 74 amu
A) double-displacement B) decomposition C) single-displacement D) combustion E) synthesis
A) double-displacement B) single-displacement C) combustion D) synthesis E) decompostion
A) synthesis B) combustion C) decompostion D) double-displacement E) single-displacement
A) double-displacement B) decomposition C) combustion D) synthesis E) single-displacement
A) combustion B) single-displacement C) double-displacement D) synthesis E) decomposition
A) oC B) L C) atm D) K
A) torr B) L C) atm D) K
A) 0.047cm3 B) 13976cm3 C) 0.001cm3 D) 395cm3
A) 1071mmHg B) 1200mmHg C) 706mmHg D) 805mmHg
A) 105.3K B) 303K C) 855K D) 581K
A) 500K B) 352K C) 421K D) 206K
A) 32atm B) 18.9atm C) 15atm D) 49atm
A) Subtract 273 B) Add 273 C) Divide by 273 D) Multiply by 273
A) 1atm B) All of these C) 101.325kPa D) 760 torr
A) Two of the above B) oC C) K D) L
A) organizing data B) communicating results C) experimentation D) research
A) growth B) music C) sunlight D) water
A) growth B) music C) sunlight D) water
A) 8.6 B) 860 C) 86000 D) 0.86
A) homegeneous mixture B) compound C) heterogeneous mixture D) element
A) hydrogen B) air C) two of these D) salt water
A) none of these B) maintain seperate identities C) combine to form new substances D) are hard to pick out
A) physical property B) chemical property
A) physical property B) chemical property
A) chemical change B) physical change
A) physical change B) chemical change
A) halogens B) alkali metals C) noble gases D) transition metals
A) by atomic mass B) alphabetically C) by atomic number D) by date of discovery
A) Thomson B) Rutherford C) Millikan
A) Thomson B) Rutherford C) Millikan
A) 6 B) 9 C) 8 D) 7
A) 6.02x1023 B) it depends on the mass C) Not enough information
A) 1s22s22p5 B) 1s12s12p6 C) 1s12s22p5 D) 1s22s22p6
A) [Ar]5s2 B) [Kr]1s22s22p63s23p64s23d104p65s2 C) [Kr]5s2 D) [Ar] 4s2
A) increases B) decreases
A) increases B) decreases
A) 4 B) 6 C) 12 D) 3
A) metallic B) special C) ionic D) covalent
A) special B) ionic C) covalent D) metallic
A) MgS B) MgS2 C) MgS4 D) Mg2S
A) CCl2 B) CCl4 C) CCl D) CCl3
A) iron (IV) chloride B) iron chloride C) iron (II) chloride D) iron dichloride
A) nitrogen hexachloride B) nitrogen chloride C) trinitrogen hexachloride D) nitrogen (III)chloride
A) shares electrons B) donates/accepts electrons
A) nothing B) number of atoms C) charge D) how much it weighs
A) two of these B) groups 1A,2A,3A and 4A C) 4A D) transition metals
A) 3,__,__,3 B) __,__,__,__ C) __,3,3,__ D) __,3,__,3
A) __,2,__,2 B) __,__,__,__ C) __2,2,__ D) 2,__,2,__
A) dividers B) subscripts C) multipliers D) coefficients
A) nonmetals B) metals C) metalloids
A) total protons B) valence electrons C) total neutrons D) total electrons
A) Cr2Cl B) CrCl C) CrCl2 D) Cr2Cl2
A) HF B) NaCl C) HCl D) NaOH
A) 25 B) 12.5g C) 0g D) 50
A) bases B) neutral C) acids
A) Ms. Watson B) ... C) ... |